| Name |
Amurensin |
| Formula |
C26H30O12 |
| Mw |
534.17372642 |
| CAS RN |
641-94-1 |
| C_ID |
C00005834
, 
|
| InChIKey |
UNHHWEHQUUGKEE-QZUBNFEHNA-N |
| InChICode |
InChI=1S/C26H30O12/c1-26(2,35)8-7-13-15(36-25-22(34)20(32)18(30)16(10-27)37-25)9-14(29)17-19(31)21(33)23(38-24(13)17)11-3-5-12(28)6-4-11/h3-6,9,16,18,20,22,25,27-30,32-35H,7-8,10H2,1-2H3/t16-,18+,20-,22+,25+/m0/s1 |
| SMILES |
CC(C)(O)CCc1c(O[C@@H]2OC(CO)[C@@H](O)[C@H](O)C2O)cc(O)c2c(=O)c(O)c(-c3ccc(O)cc3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Platanaceae | Platanus orientalis  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Phellodendron sachalinense | Ref. |
| - | - | Plantanus orientalis | Ref. |
|
|
zoom in
| Organism | Trigonella foenum-graecum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|