| Name |
Myricetin 3,7-diglucoside |
| Formula |
C27H30O18 |
| Mw |
642.14321416 |
| CAS RN |
72078-29-6 |
| C_ID |
C00005740
, 
|
| InChIKey |
ZUULHXHHLWNLGP-WIBJRXENNA-N |
| InChICode |
InChI=1S/C27H30O18/c28-5-13-17(34)20(37)22(39)26(43-13)41-8-3-9(30)15-12(4-8)42-24(7-1-10(31)16(33)11(32)2-7)25(19(15)36)45-27-23(40)21(38)18(35)14(6-29)44-27/h1-4,13-14,17-18,20-23,26-35,37-40H,5-6H2/t13-,14+,17+,18+,20-,21-,22+,23?,26+,27-/m0/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)c(-c2cc(O)c(O)c(O)c2)oc2cc(O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Acacia mangium  | Ref. |
| Plantae | Onagraceae | Oenothera dissecta | Ref. |
|
|
zoom in
| Organism | Acacia mangium | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|