| Name |
Isorhamnetin 3,4'-diglucoside
Isorhamnetin-3,4'-diglucoside |
| Formula |
C28H32O17 |
| Mw |
640.1639496 |
| CAS RN |
28288-98-4 |
| C_ID |
C00005561
, 
|
| InChIKey |
VKVBSQRURLRCHO-NATGWGOFNA-N |
| InChICode |
InChI=1S/C28H32O17/c1-40-13-4-9(2-3-12(13)42-27-23(38)21(36)18(33)15(7-29)43-27)25-26(20(35)17-11(32)5-10(31)6-14(17)41-25)45-28-24(39)22(37)19(34)16(8-30)44-28/h2-6,15-16,18-19,21-24,27-34,36-39H,7-8H2,1H3/t15-,16-,18-,19-,21+,22-,23-,24-,27-,28+/m1/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2OC(CO)[C@@H](O)C(O)C2O)ccc1O[C@@H]1OC(CO)[C@@H](O)C(O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Cruciferae | Matthiola incana | Ref. |
| Plantae | Fabaceae | Astragalus galegiformis | Ref. |
| Plantae | Fabaceae | Astragalus lasioglottis | Ref. |
| Plantae | Iridaceae | Crocus sativus | Ref. |
| Plantae | Iridaceae | Crocus spp. | Ref. |
| Plantae | Poaceae | Dactylis glomerata | Ref. |
| Plantae | Poaceae | Phleum pratense | Ref. |
| Plantae | Poaceae | Zea mays | Ref. |
| Plantae | Vitaceae | Vitis sp. | Ref. |
|
|
zoom in
| Organism | Allium cepa |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Moore,J.Am.Chem.Soc.,53,(1931),2744
Ceska,Phytochem.,23,(1984),1822 |
|---|
|
