| Name |
Isorhamnetin 3-glucuronide |
| Formula |
C22H20O13 |
| Mw |
492.09039073 |
| CAS RN |
36687-76-0 |
| C_ID |
C00005527
, 
|
| InChIKey |
VVZWHOMBDMMRSC-GAOPBNHONA-N |
| InChICode |
InChI=1S/C22H20O13/c1-32-11-4-7(2-3-9(11)24)18-19(14(26)13-10(25)5-8(23)6-12(13)33-18)34-22-17(29)15(27)16(28)20(35-22)21(30)31/h2-6,15-17,20,22-25,27-29H,1H3,(H,30,31)/t15-,16-,17+,20-,22+/m0/s1 |
| SMILES |
COc1cc(-c2oc3cc(O)cc(O)c3c(=O)c2O[C@@H]2O[C@H](C(=O)O)[C@@H](O)C(O)C2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Anethum graveolens  | Ref. |
| Plantae | Apiaceae | Anethum sowa  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Asteraceae | Arnica spp. | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata | Ref. |
| Plantae | Philydraceae | Philydrum lanuginosum | Ref. |
| Plantae | Rosaceae | Potentilla anserina  | Ref. |
| Plantae | Zingiberaceae | Roscoea cauteloides | Ref. |
| Plantae | Zingiberaceae | Roscoea humeana | Ref. |
|
|
zoom in
| Organism | Anethum graveolens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Harborne,Phytochem.,11,(1972),1741 |
|---|
|