| Name |
Quercetin 3-glucoside-7-rutinoside |
| Formula |
C33H40O21 |
| Mw |
772.20620834 |
| CAS RN |
28288-95-1 |
| C_ID |
C00005483
, 
|
| InChIKey |
VRSNQCLFKXCKDR-XYDAZNTPNA-N |
| InChICode |
InChI=1S/C33H40O21/c1-9-19(38)23(42)26(45)31(49-9)48-8-17-21(40)25(44)27(46)32(53-17)50-11-5-14(37)18-15(6-11)51-29(10-2-3-12(35)13(36)4-10)30(22(18)41)54-33-28(47)24(43)20(39)16(7-34)52-33/h2-6,9,16-17,19-21,23-28,31-40,42-47H,7-8H2,1H3/t9-,16-,17+,19-,20+,21+,23-,24-,25-,26-,27+,28+,31+,32+,33-/m0/s1 |
| SMILES |
C[C@@H]1O[C@@H](OCC2O[C@@H](Oc3cc(O)c4c(=O)c(O[C@@H]5OC(CO)[C@@H](O)C(O)C5O)c(-c5ccc(O)c(O)c5)oc4c3)C(O)[C@@H](O)[C@@H]2O)C(O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Baptisia lecontei | Ref. |
| Plantae | Fabaceae | Dolichopsis paraguariensis | Ref. |
| Plantae | Fabaceae | Macroptilium spp. | Ref. |
| Plantae | Fabaceae | Phaseolus spp. | Ref. |
| Plantae | Fabaceae | Vigna peduncularis | Ref. |
| Plantae | Orchidaceae | Orchis papilionacea | Ref. |
| Plantae | Solanaceae | Solanum spp. | Ref. |
|
|
zoom in
| Organism | Baptisia lecontei | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Markham,Phytochem.,9,(1970),2359
Steinharter,Biochem.Syst.Ecol.,14,(1986),299 |
|---|
|