| Name |
Quercetin 3-(6''-methylglucuronide) Quercetin 3-O-beta-D-glucuronide methyl ester |
| Formula |
C22H20O13 |
| Mw |
492.09039073 |
| CAS RN |
79543-28-5 |
| C_ID |
C00005377
, 
|
| InChIKey |
DAKHAONGVOPWRO-GAOPBNHONA-N |
| InChICode |
InChI=1S/C22H20O13/c1-32-21(31)20-16(29)15(28)17(30)22(35-20)34-19-14(27)13-11(26)5-8(23)6-12(13)33-18(19)7-2-3-9(24)10(25)4-7/h2-6,15-17,20,22-26,28-30H,1H3/t15-,16-,17+,20-,22+/m0/s1 |
| SMILES |
COC(=O)[C@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Polygonaceae | Polygonum equiseiforme | Ref. |
| Plantae | Polygonaceae | Polygonum perfoliatum | Ref. |
| Plantae | Tamaricaceae | Tamarix nilotica | Ref. |
|
|
zoom in
| Organism | Polygonum equiseiforme | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|