| Name |
Quercetin 3-alloside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
90327-16-5 |
| C_ID |
C00005371
, 
|
| InChIKey |
OVSQVDMCBVZWGM-UNCWLGIWNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17-,18-,21+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Hydrastidaceae | Glaucidium palmatum | Ref. |
| Plantae | Thelypteridaceae | Thelypteris formosa | Ref. |
| Plantae | Thelypteridaceae | Thelypteris nipponica | Ref. |
|
|
zoom in
| Organism | Glaucidium palmatum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Murakami,Yakugaku Zasshi,105,(1985),649
Iwashina,Phytochem.,29,(1990),3639 |
|---|
|