| Name |
Pendulin |
| Formula |
C24H26O12 |
| Mw |
506.1424263 |
| CAS RN |
14801-84-4 |
| C_ID |
C00005332
, 
|
| InChIKey |
ASCBRLGHWVZBMG-VFRGNLSONA-N |
| InChICode |
InChI=1S/C24H26O12/c1-31-13-8-12-15(17(27)22(13)32-2)18(28)23(33-3)21(35-12)10-4-6-11(7-5-10)34-24-20(30)19(29)16(26)14(9-25)36-24/h4-8,14,16,19-20,24-27,29-30H,9H2,1-3H3/t14-,16-,19+,20-,24-/m1/s1 |
| SMILES |
COc1cc2oc(-c3ccc(O[C@@H]4OC(CO)[C@@H](O)C(O)C4O)cc3)c(OC)c(=O)c2c(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Brickellia pendula | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium flagelliferum | Ref. |
| Plantae | Saxifragaceae | Chrysosplenium tetrandrum | Ref. |
|
|
zoom in
| Organism | Brickellia pendula | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Morita,Yakugaku Zasshi,88,(1968),1277
Bohm,Biochem.Syst.Ecol.,7,(1979),195 |
|---|
|