| Name |
6-Methoxykaempferol 3-glucoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
63422-27-5 |
| C_ID |
C00005316
, 
|
| InChIKey |
PMKDGKVUENNUGX-XXGUDYNLNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-20-10(25)6-11-13(15(20)27)16(28)21(19(32-11)8-2-4-9(24)5-3-8)34-22-18(30)17(29)14(26)12(7-23)33-22/h2-6,12,14,17-18,22-27,29-30H,7H2,1H3/t12-,14-,17-,18-,22+/m1/s1 |
| SMILES |
COc1c(O)cc2oc(-c3ccc(O)cc3)c(O[C@@H]3O[C@H](CO)[C@@H](O)C(O)C3O)c(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina calophylla | Ref. |
| Plantae | Asteraceae | Ageratina saltillensis | Ref. |
| Plantae | Asteraceae | Arnica amplexicaulis | Ref. |
| Plantae | Asteraceae | Arnica mollis | Ref. |
| Plantae | Asteraceae | Brickellia scoparia | Ref. |
| Plantae | Asteraceae | Decachaeta ovatifolia | Ref. |
| Plantae | Asteraceae | Eupatorium areolare | Ref. |
| Plantae | Asteraceae | Flaveria brownii | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
|
|
zoom in
| Organism | Ageratina calophylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Al-Khubaizi,Phytochem.,17,(1978),163
Khalid,Planta Med.,43,(1981),148 |
|---|
|