| Name |
Kaempferol 3-rutinoside-4'-glucoside |
| Formula |
C33H40O20 |
| Mw |
756.21129372 |
| CAS RN |
89439-58-7 |
| C_ID |
C00005247
, 
|
| InChIKey |
FYJOVKRHRUYSLY-UQUKIGOGNA-N |
| InChICode |
InChI=1S/C33H40O20/c1-10-19(37)23(41)26(44)31(48-10)47-9-17-21(39)25(43)28(46)33(52-17)53-30-22(40)18-14(36)6-12(35)7-15(18)50-29(30)11-2-4-13(5-3-11)49-32-27(45)24(42)20(38)16(8-34)51-32/h2-7,10,16-17,19-21,23-28,31-39,41-46H,8-9H2,1H3/t10-,16+,17+,19-,20+,21+,23-,24-,25-,26+,27+,28+,31+,32+,33-/m0/s1 |
| SMILES |
CC1O[C@@H](OCC2O[C@@H](Oc3c(-c4ccc(O[C@@H]5OC(CO)[C@@H](O)C(O)[C@H]5O)cc4)oc4cc(O)cc(O)c4c3=O)C(O)C(O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Geraniaceae | Erodium spp. | Ref. |
| Plantae | Geraniaceae | Geranium rotundifolium  | Ref. |
| Plantae | Geraniaceae | Geranium yemens | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
|
|
zoom in
| Organism | Erodium spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Saleh,Phytochem.,22,(1983),2501 |
|---|
|