| Name |
Kaempferol 3-rhamnoside-7-glucoside |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
64323-49-5 |
| C_ID |
C00005188
, 
|
| InChIKey |
MBLYALXOUBKFNE-IRADYMTRNA-N |
| InChICode |
InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(38-9)42-25-19(33)16-13(30)6-12(39-27-23(37)21(35)18(32)15(8-28)41-27)7-14(16)40-24(25)10-2-4-11(29)5-3-10/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9-,15+,17-,18+,20+,21-,22-,23+,26-,27+/m0/s1 |
| SMILES |
CC1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc(O)c3c2=O)[C@@H](O)C(O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Aspleniaceae | Asplenium bulbiferum  | Ref. |
| Plantae | Aspleniaceae | Asplenium kaulfussii | Ref. |
| Plantae | Betulaceae | Betula lutea  | Ref. |
| Plantae | Betulaceae | Betula nova | Ref. |
| Plantae | Betulaceae | Betula verrucosa | Ref. |
| Plantae | Fabaceae | Lotus corniculatus  | Ref. |
| Plantae | Saxifragaceae | Lithophragma bolanderi | Ref. |
|
|
zoom in
| Organism | Asplenium bulbiferum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Pawlowska,Acata Soc.Bot.Pol.,49,(1980),297
Nicholls,Can.J.Bot.,62,(1984),1636 |
|---|
|