| Name |
Leucoside Kaempferol 3-sambubioside 5,7-Dihydroxy-2-(4-hydroxyphenyl)-3-[(2-O-beta-D-xylopyranosyl-beta-D-glucopyranosyl)oxy]-4H-1-benzopyran-4-one |
| Formula |
C26H28O15 |
| Mw |
580.14282023 |
| CAS RN |
27661-51-4 |
| C_ID |
C00005163
, 
|
| InChIKey |
RXAXTTGJEMODPY-RTHVLYDYNA-N |
| InChICode |
InChI=1S/C26H28O15/c27-7-15-18(33)20(35)24(41-25-21(36)17(32)13(31)8-37-25)26(39-15)40-23-19(34)16-12(30)5-11(29)6-14(16)38-22(23)9-1-3-10(28)4-2-9/h1-6,13,15,17-18,20-21,24-33,35-36H,7-8H2/t13-,15+,17-,18+,20-,21-,24+,25-,26-/m0/s1 |
| SMILES |
O=c1c(O[C@@H]2OC(CO)[C@@H](O)C(O)C2O[C@@H]2OC[C@@H](O)C(O)[C@H]2O)c(-c2ccc(O)cc2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Actinidiaceae | Actinidia melanandra | Ref. |
| Plantae | Amaryllidaceae | Leucojum vernum | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Fabaceae | Astragalus complanatus  | Ref. |
| Plantae | Fabaceae | Lathyrus chloranthus | Ref. |
| Plantae | Liliaceae | Lilium candidum  | Ref. |
| Plantae | Ranunculaceae | Helleborus niger  | Ref. |
| Plantae | Rubiaceae | Galium sinaicum | Ref. |
|
|
zoom in
| Organism | Actinidia melanandra | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 297.Flavonol O-glycosides
Chari,Chem.Ber.,109,(1976),426 |
|---|
|