| Name |
Karanjin 3-Methoxy-2-phenyl-4H-Furo[2,3-h]-1-benzopyran-4-one |
| Formula |
C18H12O4 |
| Mw |
292.07355887 |
| CAS RN |
521-88-0 |
| C_ID |
C00005089
, 
|
| InChIKey |
LKPQNZRGGNOPPU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H12O4/c1-20-18-15(19)13-7-8-14-12(9-10-21-14)17(13)22-16(18)11-5-3-2-4-6-11/h2-10H,1H3 |
| SMILES |
COc1c(-c2ccccc2)oc2c(ccc3occc32)c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dahlstedtia pentaphylla | Ref. |
| Plantae | Fabaceae | Derris indica  | Ref. |
| Plantae | Fabaceae | Derris mollis | Ref. |
| Plantae | Fabaceae | Millettia leucantha | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia glabra  | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| - | - | Fardia cauliflora | Ref. |
| - | - | Pongania pinnata | Ref. |
|
|
zoom in
| Organism | Dahlstedtia pentaphylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Limaye,Proc.Indian.Sci.Congr.,(1926),151
Rangaswami,Proc.Indian Acad. Sci.Sect.A.,9,(1939),259 |
|---|
|