| Name |
Karanjachromene Pongaflavone 3-Methoxy-8,8-dimethyl-2-phenyl-4H,8H-benzo[1,2-b:3,4-b']dipyran-4-one |
| Formula |
C21H18O4 |
| Mw |
334.12050906 |
| CAS RN |
38070-93-8 |
| C_ID |
C00005072
, 
|
| InChIKey |
QCLBGWSAIHOGCA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H18O4/c1-21(2)12-11-14-16(25-21)10-9-15-17(22)20(23-3)18(24-19(14)15)13-7-5-4-6-8-13/h4-12H,1-3H3 |
| SMILES |
COc1c(-c2ccccc2)oc2c3c(ccc2c1=O)OC(C)(C)C=C3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Dahlstedtia pentaphylla | Ref. |
| Plantae | Fabaceae | Derris indica  | Ref. |
| Plantae | Fabaceae | Lonchocarpus latifolius | Ref. |
| Plantae | Fabaceae | Millettia hemsleyana | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
|
|
zoom in
| Organism | Dahlstedtia pentaphylla | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Satam,Indian J.Chem.,11,(1973),1188 |
|---|
|