| Name |
Melibentin 3,5,6,7,8-Pentamethoxy-3',4'-methylenedioxyflavone 2-(1,3-Benzodioxol-5-yl)-3,5,6,7,8-pentamethoxy-4H-1-benzopyran-4-one |
| Formula |
C21H20O9 |
| Mw |
416.11073224 |
| CAS RN |
5071-42-1 |
| C_ID |
C00005066
, 
|
| InChIKey |
CRSVEURWRGBEIE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H20O9/c1-23-16-13-14(22)18(24-2)15(10-6-7-11-12(8-10)29-9-28-11)30-17(13)20(26-4)21(27-5)19(16)25-3/h6-8H,9H2,1-5H3 |
| SMILES |
COc1c(OC)c(OC)c2c(=O)c(OC)c(-c3ccc4c(c3)OCO4)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Melicope broadbentiana | Ref. |
| Plantae | Rutaceae | Melicope indica | Ref. |
| Plantae | Rutaceae | Melicope ternata  | Ref. |
| Plantae | Rutaceae | Melicope triphylla | Ref. |
|
|
zoom in
| Organism | Melicope broadbentiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ritchie,Aust.J.Chem.,18,(1965),2021 |
|---|
|