| Name |
6-C-Methylquercetin 3,7,3'-trimethyl ether 5-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-3,7-dimethoxy-6-methyl-4H-1-benzopyran-4-one |
| Formula |
C19H18O7 |
| Mw |
358.10525293 |
| CAS RN |
99339-48-7 |
| C_ID |
C00004899
, 
|
| InChIKey |
DHMDSOOMIYBNSO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O7/c1-9-12(23-2)8-14-15(16(9)21)17(22)19(25-4)18(26-14)10-5-6-11(20)13(7-10)24-3/h5-8,20-21H,1-4H3 |
| SMILES |
COc1cc(-c2oc3cc(OC)c(C)c(O)c3c(=O)c2OC)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Didiereaceae | Alluaudia humbertii | Ref. |
| Plantae | Fabaceae | Piliostigma thonningii  | Ref. |
| Plantae | Myrtaceae | Callistemon salignus | Ref. |
| Plantae | Myrtaceae | Leptospermum laevigatum | Ref. |
|
|
zoom in
| Organism | Alluaudia humbertii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Rabesa,C.R.Acad.Sci.Ser.C,301,(1985),351 |
|---|
|