| Name |
8-Desmethylkalmiatin |
| Formula |
C19H18O6 |
| Mw |
342.11033831 |
| CAS RN |
70059-34-6 |
| C_ID |
C00004887
, 
|
| InChIKey |
DFXKVAVMILIIHO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O6/c1-10-13(23-3)9-14-15(16(10)20)17(21)19(24-4)18(25-14)11-5-7-12(22-2)8-6-11/h5-9,20H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3cc(OC)c(C)c(O)c3c(=O)c2OC)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Kalmia latifolia  | Ref. |
| Plantae | Myrtaceae | Callistemon acuminatus | Ref. |
| Plantae | Myrtaceae | Callistemon cocineus | Ref. |
| Plantae | Myrtaceae | Callistemon juniperinus | Ref. |
| Plantae | Myrtaceae | Callistemon macropunctatus | Ref. |
| Plantae | Myrtaceae | Callistemon rigidus | Ref. |
| Plantae | Myrtaceae | Callistemon salignus | Ref. |
| Plantae | Myrtaceae | Callistemon salignus var.viridiflorus | Ref. |
| Plantae | Myrtaceae | Callistemon speciosus | Ref. |
| Plantae | Myrtaceae | Callistemon teretifolius | Ref. |
|
|
zoom in
| Organism | Kalmia latifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wollenweber,Z.Naturforsch.C.,39,(1984),710 |
|---|
|