| Name |
5-Hydroxy-3,6,7,3',4',5'-hexamethoxyflavone 5-Hydroxy-3,6,7-trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-Benzopyran-4-one |
| Formula |
C21H22O9 |
| Mw |
418.1263823 |
| CAS RN |
17245-31-7 |
| C_ID |
C00004836
, 
|
| InChIKey |
XZKJITYVVLNMNW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C21H22O9/c1-24-12-7-10(8-13(25-2)19(12)27-4)18-21(29-6)17(23)15-11(30-18)9-14(26-3)20(28-5)16(15)22/h7-9,22H,1-6H3 |
| SMILES |
COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2OC)cc(OC)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Centipeda amplyocarpa | Ref. |
| Plantae | Asteraceae | Centipeda orbicularis  | Ref. |
| Plantae | Capparaceae | Cleome amplyocarpa | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
|
|
zoom in
| Organism | Centipeda amplyocarpa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Sharaf,Biochem.Syst.Ecol.,20,(1992),443 |
|---|
|