| Name |
5,3',4'-Trihydroxy-3,6,7,8-tetramethoxyflavone 5,4',5'-Trihydroxy-3,6,7,8-tetramethoxyflavone 2-(3,4-Dihydroxyphenyl)-5-hydroxy-3,6,7,8-tetramethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O9 |
| Mw |
390.09508217 |
| CAS RN |
81943-52-4 |
| C_ID |
C00004793
, 
|
| InChIKey |
WQDGAXUSPJAKPY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O9/c1-24-16-12(22)11-13(23)17(25-2)19(27-4)18(26-3)15(11)28-14(16)8-5-6-9(20)10(21)7-8/h5-7,20-21,23H,1-4H3 |
| SMILES |
COc1c(OC)c(O)c2c(=O)c(OC)c(-c3ccc(O)c(O)c3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Calycadenia ciliosa | Ref. |
| Plantae | Asteraceae | Calycadenia multiglandulosa | Ref. |
| Plantae | Asteraceae | Gutierrezia resinosa | Ref. |
| Plantae | Asteraceae | Gutierrezia texana | Ref. |
| Plantae | Asteraceae | Helichrysum spp. | Ref. |
| Plantae | Asteraceae | Madia spp. | Ref. |
| Plantae | Asteraceae | Wilkesia hobdyi | Ref. |
| Plantae | Labiatae | Stachys aegyptiaca | Ref. |
|
|
zoom in
| Organism | Calycadenia ciliosa | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Bittner,Phytochem.,22,(1983),1523
Emerson,Biochem.Syst.Ecol.,14,(1986),29 |
|---|
|