| Name |
Gossypetin 3,7,8,4'-tetramethyl ether 5,3'-Dihydroxy-3,7,8,4'-tetramethoxyflavone 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-3,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O8 |
| Mw |
374.10016755 |
| CAS RN |
4670-37-5 |
| C_ID |
C00004738
, 
|
| InChIKey |
TUEHVMYACGCKDL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O8/c1-23-12-6-5-9(7-10(12)20)16-19(26-4)15(22)14-11(21)8-13(24-2)17(25-3)18(14)27-16/h5-8,20-21H,1-4H3 |
| SMILES |
COc1ccc(-c2oc3c(OC)c(OC)cc(O)c3c(=O)c2OC)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Ricinocarpos muricatus | Ref. |
| Plantae | Euphorbiaceae | Ricinocarpos stylosus | Ref. |
| Plantae | Solanaceae | Solanum paludosum  | Ref. |
|
|
zoom in
| Organism | Ricinocarpos muricatus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Henrick,Aust.J.Chem.,17,(1964),934 |
|---|
|