| Name |
Veronicafolin |
| Formula |
C18H16O8 |
| Mw |
360.08451749 |
| CAS RN |
578-71-2 |
| C_ID |
C00004697
, 
|
| InChIKey |
RQJFJWHHIIPKGW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O8/c1-23-10-6-8(4-5-9(10)19)17-16(22)14(20)13-11(26-17)7-12(24-2)18(25-3)15(13)21/h4-7,19,21-22H,1-3H3 |
| SMILES |
COc1cc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Arnica longifolia | Ref. |
| Plantae | Asteraceae | Brickellia chlorolepis | Ref. |
| Plantae | Asteraceae | Brickellia veronicifolia | Ref. |
| Plantae | Asteraceae | Rudbeckia serotina | Ref. |
|
|
zoom in
| Organism | Arnica longifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Roberts,Phytochem.,19,(1980),127 |
|---|
|