| Name |
Transilitin 3',4',7,8-Tetrahydroxy-3-methoxyflavone 2-(3,4-Dihydroxyphenyl)-7,8-dihydroxy-3-methoxy-4H-1-benzopyran-4-one |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
26788-86-3 |
| C_ID |
C00004661
, 
|
| InChIKey |
WGIWCQHSJILTOY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-16-12(20)8-3-5-10(18)13(21)15(8)23-14(16)7-2-4-9(17)11(19)6-7/h2-6,17-19,21H,1H3 |
| SMILES |
COc1c(-c2ccc(O)c(O)c2)oc2c(O)c(O)ccc2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia transiliensis | Ref. |
| Plantae | Fabaceae | Acacia cyperophylla | Ref. |
| Plantae | Fabaceae | Acacia nigrescens | Ref. |
| Plantae | Fabaceae | Acacia sowdenii | Ref. |
|
|
zoom in
| Organism | Artemisia transiliensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Chumbalv,Khim.Prir.Soedin,5,(1969),439 |
|---|
|