| Name |
5,6,7,4'-Tetrahydroxy-3-methoxyflavone |
| Formula |
C16H12O7 |
| Mw |
316.05830274 |
| CAS RN |
76060-25-8 |
| C_ID |
C00004591
, 
|
| InChIKey |
DAEBTLQZOWXOBW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O7/c1-22-16-14(21)11-10(6-9(18)12(19)13(11)20)23-15(16)7-2-4-8(17)5-3-7/h2-6,17-20H,1H3 |
| SMILES |
COc1c(-c2ccc(O)cc2)oc2cc(O)c(O)c(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina deltoidea | Ref. |
| Plantae | Asteraceae | Ageratina havanensis | Ref. |
| Plantae | Asteraceae | Neurolaena oaxacana | Ref. |
| Plantae | Hydrophyllaceae | Eriodictyon trichocalyx | Ref. |
|
|
zoom in
| Organism | Ageratina deltoidea | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Ulubelen,Phytochem.,19,(1980),1761 |
|---|
|