| Name |
Methylgnaphaliin 5-Hydroxy-3,7,8-trimethoxyflavone 5-Hydroxy-3,7,8-trimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C18H16O6 |
| Mw |
328.09468824 |
| CAS RN |
22399-74-2 |
| C_ID |
C00004559
, 
|
| InChIKey |
GMKBLHXKYVSJSF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O6/c1-21-12-9-11(19)13-14(20)18(23-3)15(10-7-5-4-6-8-10)24-17(13)16(12)22-2/h4-9,19H,1-3H3 |
| SMILES |
COc1cc(O)c2c(=O)c(OC)c(-c3ccccc3)oc2c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline bogotensis | Ref. |
| Plantae | Asteraceae | Gnaphalium obtusifolium | Ref. |
| Plantae | Asteraceae | Gnaphalium robustum | Ref. |
| Plantae | Asteraceae | Ozothamnus expansifolius | Ref. |
| Plantae | Asteraceae | Ozothamnus hookeri | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus solandri | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus truncata | Ref. |
|
|
zoom in
| Organism | Achyrocline bogotensis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wagner,Chem.Ber.,104<(1971),2381 |
|---|
|