| Name |
Gnaphaliin 5,7-Dihydroxy-3,8-dimethoxyflavone 3-O-Methyl-8-methoxygalangin 5,7-Dihydroxy-3,8-dimethoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
33803-42-8 |
| C_ID |
C00004556
, 
|
| InChIKey |
OWQLBLNRUZULFV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-15-11(19)8-10(18)12-13(20)17(22-2)14(23-16(12)15)9-6-4-3-5-7-9/h3-8,18-19H,1-2H3 |
| SMILES |
COc1c(-c2ccccc2)oc2c(OC)c(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline spp. | Ref. |
| Plantae | Asteraceae | Anaphalis margaritacea | Ref. |
| Plantae | Asteraceae | Gnaphalium luteo-album  | Ref. |
| Plantae | Asteraceae | Gnaphalium microcephalum | Ref. |
| Plantae | Asteraceae | Gnaphalium obtusifolium | Ref. |
| Plantae | Asteraceae | Gnaphalium robustum | Ref. |
| Plantae | Asteraceae | Gymnosperma glutinosum  | Ref. |
| Plantae | Asteraceae | Helichrysum aureum | Ref. |
| Plantae | Asteraceae | Helichrysum bracteiferum | Ref. |
| Plantae | Asteraceae | Helichrysum italicum  | Ref. |
| Plantae | Asteraceae | Helichrysum picardii | Ref. |
| Plantae | Asteraceae | Ozothamnus ericifolius | Ref. |
| Plantae | Asteraceae | Ozothamnus purpurescens | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus alessandri | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
| Plantae | Woodsiaceae/Dryopteridaceae | Woodsia scopulina | Ref. |
|
|
zoom in
| Organism | Achyrocline spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Wagner,Chem.Ber.,104,(1971),2381
Opitz,Phytochem.,10,(1971),1948) |
|---|
|