| Name |
8-Hydroxygalangin 3-methyl ether 5,7,8-Trihydroxy-3-methoxyflavone 5,7,8-Trihydroxy-3-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
33910-28-0 |
| C_ID |
C00004552
, 
|
| InChIKey |
IDYSOKBAVNNCSS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-16-13(20)11-9(17)7-10(18)12(19)15(11)22-14(16)8-5-3-2-4-6-8/h2-7,17-19H,1H3 |
| SMILES |
COc1c(-c2ccccc2)oc2c(O)c(O)cc(O)c2c1=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Achyrocline flaccida | Ref. |
| Plantae | Asteraceae | Gnaphalium robustum | Ref. |
| Plantae | Asteraceae | Ozothamnus spp. | Ref. |
| Plantae | Nothofagaceae/Fagaceae | Nothofagus spp. | Ref. |
|
|
zoom in
| Organism | Achyrocline flaccida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Norbedo,Phytochem.,23,(1984),2698 |
|---|
|