| Name |
3,7-Dihydroxyflavone |
| Formula |
C15H10O4 |
| Mw |
254.05790881 |
| CAS RN |
492-00-2 |
| C_ID |
C00004531
, 
|
| InChIKey |
UWQJWDYDYIJWKY-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O4/c16-10-6-7-11-12(8-10)19-15(14(18)13(11)17)9-4-2-1-3-5-9/h1-8,16,18H |
| SMILES |
O=c1c(O)c(-c2ccccc2)oc2cc(O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Astragalus centralpinus | Ref. |
| Plantae | Fabaceae | Platymiscium praecox | Ref. |
| Plantae | Fabaceae | Zuccagnia punctata  | Ref. |
|
|
zoom in
| Organism | Astragalus centralpinus | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Braga de Oliveira, Phytochem.,11,(1972),3515 |
|---|
|