| Name |
5,6,7,3',4'-Pentahydroxy-8-methoxyflavone 7-apioside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
|
| C_ID |
C00004437
, 
|
| InChIKey |
IXFAKKDXPKSFDT-ZEROODLHNA-N |
| InChICode |
InChI=1S/C21H20O12/c1-30-18-16-13(11(25)5-12(32-16)8-2-3-9(23)10(24)4-8)14(26)15(27)17(18)33-20-19(28)21(29,6-22)7-31-20/h2-5,19-20,22-24,26-29H,6-7H2,1H3/t19-,20-,21-/m0/s1 |
| SMILES |
COc1c(O[C@@H]2OCC(O)(CO)C2O)c(O)c(O)c2c(=O)cc(-c3ccc(O)c(O)c3)oc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Velloziaceae | Pleurostima caricina | Ref. |
| Plantae | Velloziaceae | Pleurostima pabstiana | Ref. |
| Plantae | Velloziaceae | Pleurostima purpurea | Ref. |
|
|
zoom in
| Organism | Pleurostima caricina | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Williams,Biochem.Syst.Ecol.,19,(1991),483 |
|---|
|