| Name |
6-Hydroxyluteolin 7-methyl ether 6-galactoside |
| Formula |
C22H22O12 |
| Mw |
478.11112617 |
| CAS RN |
76449-91-7 |
| C_ID |
C00004404
, 
|
| InChIKey |
WLDSVYQTJXGHOT-RLRUXENZNA-N |
| InChICode |
InChI=1S/C22H22O12/c1-31-14-6-13-16(11(26)5-12(32-13)8-2-3-9(24)10(25)4-8)18(28)21(14)34-22-20(30)19(29)17(27)15(7-23)33-22/h2-6,15,17,19-20,22-25,27-30H,7H2,1H3/t15-,17-,19-,20+,22-/m0/s1 |
| SMILES |
COc1cc2oc(-c3ccc(O)c(O)c3)cc(=O)c2c(O)c1O[C@@H]1OC(CO)[C@H](O)[C@H](O)C1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Saxifragaceae | Sullivantia halmicola | Ref. |
| Plantae | Saxifragaceae | Sullivantia oregana | Ref. |
| Plantae | Saxifragaceae | Sullivantia purpusii | Ref. |
|
|
zoom in
| Organism | Sullivantia halmicola | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Soltis,Biochem.Syst.Ecol.,8,(1980),149 |
|---|
|