| Name |
Luteolin 7,3'-dimethyl ether 4'-apiosyl-(1->2)-glucoside Homoflavoyadorinin B 2-[4-[(2-O-D-Apio-beta-D-furanosyl-beta-D-glucopyranosyl)oxy]-3-methoxyphenyl]-5-hydroxy-7-methoxy-4H-1-benzopyran-4-one |
| Formula |
C28H32O15 |
| Mw |
608.17412036 |
| CAS RN |
30422-47-0 |
| C_ID |
C00004372
, 
|
| InChIKey |
HXGMFRZFNQCALH-QIYWIXRGNA-N |
| InChICode |
InChI=1S/C28H32O15/c1-37-13-6-14(31)21-15(32)8-17(40-19(21)7-13)12-3-4-16(18(5-12)38-2)41-26-24(23(34)22(33)20(9-29)42-26)43-27-25(35)28(36,10-30)11-39-27/h3-8,20,22-27,29-31,33-36H,9-11H2,1-2H3/t20-,22-,23+,24-,25+,26+,27-,28+/m0/s1 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccc(O[C@@H]4OC(CO)[C@@H](O)C(O)C4O[C@@H]4OCC(O)(CO)[C@@H]4O)c(OC)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Santalaceae | Viscum album  | Ref. |
| Plantae | Santalaceae | Viscum alniformosanae  | Ref. |
|
|
zoom in
| Organism | Viscum album | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Ohta,Agric.Biol.Chem.,34,(1970),900 |
|---|
|