| Name |
Luteolin 3'-methyl ether 7-apiosyl-(1->2)-glucoside Graveobioside B |
| Formula |
C27H30O15 |
| Mw |
594.15847029 |
| CAS RN |
33579-63-4 |
| C_ID |
C00004342
, 
|
| InChIKey |
GYQQQCVFOLKXGH-BGDPFAMQNA-N |
| InChICode |
InChI=1S/C27H30O15/c1-37-17-4-11(2-3-13(17)30)16-7-15(32)20-14(31)5-12(6-18(20)40-16)39-25-23(22(34)21(33)19(8-28)41-25)42-26-24(35)27(36,9-29)10-38-26/h2-7,19,21-26,28-31,33-36H,8-10H2,1H3/t19-,21+,22+,23-,24-,25-,26-,27+/m1/s1 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O[C@H]4OCC(O)(CO)C4O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Petroselinum hortense  | Ref. |
| Plantae | Fabaceae | Dalbergia monetaria  | Ref. |
|
|
zoom in
| Organism | Apium graveolens | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Farooq,J.Sci.Ind.Res.India,12B,(1953),400 |
|---|
|