| Name |
5,7,3',4'-Tetrahydroxyflavone 4'-beta-D-glucopyranoside Luteolin 4'-O-beta-D-glucopyranoside Luteolin 4'-glucoside Juncein Luteolin-4'-O-glucoside Luteolin-4'-O-beta-D-glucoside |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
6920-38-3 |
| C_ID |
C00004276
, 
|
| InChIKey |
UHNXUSWGOJMEFO-CFBYCNAUNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-13-2-1-8(3-10(13)24)14-6-12(26)17-11(25)4-9(23)5-15(17)30-14/h1-6,16,18-25,27-29H,7H2/t16-,18-,19-,20+,21-/m1/s1 |
| SMILES |
O=c1cc(-c2ccc(O[C@@H]3OC(CO)[C@@H](O)C(O)C3O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apocynaceae | Trachelospermum jasminoides | Ref. |
| Plantae | Asteraceae | Gnaphalium affine  | Ref. |
| Plantae | Asteraceae | Helichrysum graveolen | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Fabaceae | Bauhinia tarapotensis | Ref. |
| Plantae | Fabaceae | Genista corsica | Ref. |
| Plantae | Fabaceae | Kummerowia striata  | Ref. |
| Plantae | Fabaceae | Lathyrus pratensis | Ref. |
| Plantae | Fabaceae | Lupinus polyphyllus | Ref. |
| Plantae | Fabaceae | Spartium junceum  | Ref. |
| Plantae | Hypericaceae | Hypericum erectum Thunb. | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
| Plantae | Solanaceae | Physalis alkekengi var. franchetii  | Ref. |
| Plantae | Uvulariaceae | Disporum cantoniense | Ref. |
|
|
zoom in
| Organism | Trachelospermum jasminoides | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Nikaido, et al., Chem Pharm Bull, 36, (1988), 654.
Nishibe, et al., J of Natural Medicines(Japan), 41, (1987), 116.
Calixto, et al., Planta Med, 70, (2004), 93.
XIE, et al., Chem Pharm Bull, 53, (2005), 1416 |
|---|
|