| Name |
Acacetin 7-glucoside Apigenin 4'-methyl ether 7-glucoside tilianin moldavoside |
| Formula |
C22H22O10 |
| Mw |
446.12129692 |
| CAS RN |
4291-60-5 |
| C_ID |
C00004201
, 
|
| InChIKey |
NLZCOTZRUWYPTP-OXFOAJKANA-N |
| InChICode |
InChI=1S/C22H22O10/c1-29-11-4-2-10(3-5-11)15-8-14(25)18-13(24)6-12(7-16(18)31-15)30-22-21(28)20(27)19(26)17(9-23)32-22/h2-8,17,19-24,26-28H,9H2,1H3/t17-,19+,20-,21+,22+/m0/s1 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)cc(O[C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Carduus nutans | Ref. |
| Plantae | Malvaceae | Tilia japonica | Ref. |
|
|
zoom in
| Organism | Carduus nutans | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Kaloshina,Khim.Prir.Soedin.,3,(1988),453 |
|---|
|