| Name |
Apigenin 7-neohesperidoside-4'-glucoside Rhoifolin 4'-glucoside |
| Formula |
C33H40O19 |
| Mw |
740.2163791 |
| CAS RN |
31498-83-6 |
| C_ID |
C00004167
, 
|
| InChIKey |
PTKZEWKSNFRXLZ-CQVVGNILNA-N |
| InChICode |
InChI=1S/C33H40O19/c1-11-22(38)25(41)28(44)31(46-11)52-30-27(43)24(40)20(10-35)51-33(30)48-14-6-15(36)21-16(37)8-17(49-18(21)7-14)12-2-4-13(5-3-12)47-32-29(45)26(42)23(39)19(9-34)50-32/h2-8,11,19-20,22-36,38-45H,9-10H2,1H3/t11-,19-,20-,22-,23+,24+,25-,26-,27-,28+,29-,30-,31-,32+,33+/m0/s1 |
| SMILES |
CC1O[C@@H](OC2[C@H](Oc3cc(O)c4c(=O)cc(-c5ccc(O[C@@H]6O[C@@H](CO)[C@@H](O)C(O)C6O)cc5)oc4c3)OC(CO)[C@@H](O)[C@@H]2O)C(O)[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Burseraceae | Hedwigia ciliata | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
|
|
zoom in
| Organism | Hedwigia ciliata | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Osterdahl,Acta Chem.Scand.,33,(1979),119 |
|---|
|