| Name |
Apigenin-7-O-beta-D-glucuronide methyl ester Apigenin 7-O-beta-D-glucuronopyranoside methyl ester Apigenin-7-O-glucuronide methyl ester |
| Formula |
C22H20O11 |
| Mw |
460.10056148 |
| CAS RN |
53538-13-9 |
| C_ID |
C00004146
, 
|
| InChIKey |
XXKIWCKZQFBXIR-ACYPGOOPNA-N |
| InChICode |
InChI=1S/C22H20O11/c1-30-21(29)20-18(27)17(26)19(28)22(33-20)31-11-6-12(24)16-13(25)8-14(32-15(16)7-11)9-2-4-10(23)5-3-9/h2-8,17-20,22-24,26-28H,1H3/t17-,18-,19+,20+,22+/m0/s1 |
| SMILES |
COC(=O)C1O[C@@H](Oc2cc(O)c3c(=O)cc(-c4ccc(O)cc4)oc3c2)C(O)[C@@H](O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Asteraceae | Bellis perennis  | Ref. |
| Plantae | Moraceae | Broussonetia papyrifera  | Ref. |
|
|
zoom in
| Organism | Strobilanthes crispus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|