| Name |
Echioidin |
| Formula |
C22H22O10 |
| Mw |
446.12129692 |
| CAS RN |
6736-71-6 |
| C_ID |
C00004138
, 
|
| InChIKey |
NCWUWWMZUSHZKJ-OXFOAJKANA-N |
| InChICode |
InChI=1S/C22H22O10/c1-29-10-6-12(24)18-13(25)8-15(30-16(18)7-10)11-4-2-3-5-14(11)31-22-21(28)20(27)19(26)17(9-23)32-22/h2-8,17,19-24,26-28H,9H2,1H3/t17-,19-,20+,21-,22-/m1/s1 |
| SMILES |
COc1cc(O)c2c(=O)cc(-c3ccccc3O[C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Andrographis echioides  | Ref. |
| Plantae | Acanthaceae | Andrographis rothii | Ref. |
| Plantae | Acanthaceae | Andrographis viscosula | Ref. |
|
|
zoom in
| Organism | Andrographis echioides | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Govindachari,Tetrahedron,21,(1965),3715 |
|---|
|