| Name |
Chrysin 7-O-beta-galactopyranoside Chrysin 7-galactoside |
| Formula |
C21H20O9 |
| Mw |
416.11073224 |
| CAS RN |
73036-52-9 |
| C_ID |
C00004111
, 
|
| InChIKey |
PIJHQWMTZXDYER-AGCSSVCMNA-N |
| InChICode |
InChI=1S/C21H20O9/c22-9-16-18(25)19(26)20(27)21(30-16)28-11-6-12(23)17-13(24)8-14(29-15(17)7-11)10-4-2-1-3-5-10/h1-8,16,18-23,25-27H,9H2/t16-,18-,19-,20-,21+/m0/s1 |
| SMILES |
O=c1cc(-c2ccccc2)oc2cc(O[C@@H]3OC(CO)[C@H](O)[C@H](O)C3O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Aerva persica | Ref. |
| Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
|
|
zoom in
| Organism | Aerva persica | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 3.Flavone O-glycosides, John Wiley & Son
Garg,Indian J.Chem. Sect.B, 17,(1979),416 |
|---|
|