| Name |
Artobiloxanthone 8,9-Dihydro-6,10,11,13-tetrahydroxy-3,3-dimethyl-9-(1-methylethenyl)-3H,7H-benzo[c]pyrano[3,2-h]xanthen-7-one |
| Formula |
C25H22O7 |
| Mw |
434.13655306 |
| CAS RN |
121748-25-2 |
| C_ID |
C00004104
, 
|
| InChIKey |
ZIYAGIMFLYOZDS-STGVRZAANA-N |
| InChICode |
InChI=1S/C25H22O7/c1-10(2)12-7-13-21(29)20-15(27)9-17-11(5-6-25(3,4)32-17)23(20)31-24(13)19-14(26)8-16(28)22(30)18(12)19/h5-6,8-9,12,26-28,30H,1,7H2,2-4H3/t12-/m0/s1 |
| SMILES |
C=C(C)[C@@H]1Cc2c(oc3c4c(cc(O)c3c2=O)OC(C)(C)C=C4)-c2c(O)cc(O)c(O)c21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus communis  | Ref. |
| Plantae | Moraceae | Artocarpus lanceifolius Roxb. | Ref. |
| Plantae | Moraceae | Artocarpus nobilis | Ref. |
| Plantae | Moraceae | Artocarpus scortechinii King  | Ref. |
| Plantae | Moraceae | Artocarpus teysmanii Miq. | Ref. |
|
|
zoom in
| Organism | Artocarpus communis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Fujimoto,Chem.Pharm.Bull.,38,(1990),1787 |
|---|
|