| Name |
Isocyclomulberrin (+)-3,8,10-Trihydroxy-9-(3-methyl-2-butenyl)-6-(2-methyl-1-propenyl)-6H,7H-[1]benzopyrano[4,3-b][1]benzopyran-7-one |
| Formula |
C25H24O6 |
| Mw |
420.1572885 |
| CAS RN |
152186-79-3 |
| C_ID |
C00004099
, 
|
| InChIKey |
PWHGUSAQRRPLSJ-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C25H24O6/c1-12(2)5-7-15-17(27)11-20-21(23(15)28)24(29)22-19(9-13(3)4)30-18-10-14(26)6-8-16(18)25(22)31-20/h5-6,8-11,19,26-28H,7H2,1-4H3/t19-/m0/s1 |
| SMILES |
CC(C)=CCc1c(O)cc2oc3c(c(=O)c2c1O)C(C=C(C)C)Oc1cc(O)ccc1-3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Moraceae | Artocarpus altilis  | Ref. |
| Plantae | Moraceae | Artocarpus communis  | Ref. |
| Plantae | Moraceae | Artocarpus elasticus  | Ref. |
|
|
zoom in
| Organism | Artocarpus altilis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Chen,J.Nat.Prod.,56,(1993),1594 |
|---|
|