| Name |
Cycloartocarpesin 8-(2,4-Dihydroxyphenyl)-5-hydroxy-2,2-dimethyl-2H,6H-benzo[1,2-b:5,4-b']dipyran-6-one |
| Formula |
C20H16O6 |
| Mw |
352.09468824 |
| CAS RN |
23806-61-3 |
| C_ID |
C00004053
, 
|
| InChIKey |
LXEJWVDCRDILQQ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O6/c1-20(2)6-5-12-16(26-20)9-17-18(19(12)24)14(23)8-15(25-17)11-4-3-10(21)7-13(11)22/h3-9,21-22,24H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc3oc(-c4ccc(O)cc4O)cc(=O)c3c2O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bracteata | Ref. |
| Plantae | Moraceae | Artocarpus heterophyllus  | Ref. |
| Plantae | Moraceae | Cudrania tricuspidata  | Ref. |
| Plantae | Moraceae | Maclura pomifera | Ref. |
|
|
zoom in
| Organism | Garcinia bracteata | | Reference | Aravind, A. P. A et al., Diversity of Garcinia species in the Western Ghats: Phytochemical Perspective, Chapter 2, (2016), p.19-70. |
|---|
|