| Name |
8-Desmethyleucalyptin 8-Demethyleucalyptin 5-Hydroxy-7,4'-dimethoxy-6-methylflavone 5-Hydroxy-7-methoxy-2-(4-methoxyphenyl)-6-methyl-4H-1-benzopyran-4-one |
| Formula |
C18H16O5 |
| Mw |
312.09977362 |
| CAS RN |
5689-38-3 |
| C_ID |
C00003990
, 
|
| InChIKey |
QPWOSZAYIILLKU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C18H16O5/c1-10-14(22-3)9-16-17(18(10)20)13(19)8-15(23-16)11-4-6-12(21-2)7-5-11/h4-9,20H,1-3H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(O)c(C)c(OC)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Artemisia austriaca | Ref. |
| Plantae | Ericaceae | Gaultheria procumbens  | Ref. |
| Plantae | Ericaceae | Kalmia spp. | Ref. |
| Plantae | Myrtaceae | Callistemon juniperinus | Ref. |
| Plantae | Myrtaceae | Callistemon rigidus | Ref. |
| Plantae | Myrtaceae | Callistemon salignus | Ref. |
| Plantae | Myrtaceae | Callistemon salignus var.viridiflorus | Ref. |
| Plantae | Myrtaceae | Callistemon speciosus | Ref. |
| Plantae | Myrtaceae | Callistemon spp.  | Ref. |
| Plantae | Myrtaceae | Callistemon teretifolius | Ref. |
| Plantae | Myrtaceae | Eucalyptus torelliana | Ref. |
| Plantae | Myrtaceae | Lophostemon palustre | Ref. |
|
|
zoom in
| Organism | Artemisia austriaca | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Hillis,Phytochem.,4,(1965),541
Courtney,Phytochem.,22,(1983),947 |
|---|
|