| Name |
Strobochrysin 5,7-Dihydroxy-6-methylflavone 5,7-Dihydroxy-6-methyl-2-phenyl-4H-1-benzopyran-4-one |
| Formula |
C16H12O4 |
| Mw |
268.07355887 |
| CAS RN |
529-52-2 |
| C_ID |
C00003985
, 
|
| InChIKey |
XRJWLVUOUWIPHW-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O4/c1-9-11(17)7-14-15(16(9)19)12(18)8-13(20-14)10-5-3-2-4-6-10/h2-8,17,19H,1H3 |
| SMILES |
Cc1c(O)cc2oc(-c3ccccc3)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Dennstaedtiaceae | Lonchitis tisserantii | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Pinaceae | Pinus strobus | Ref. |
|
|
zoom in
| Organism | Lonchitis tisserantii | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harborne,Comparative Biochemistry of the Flavonoids,(1967),121,Academic Press |
|---|
|