| Name |
Gardenin C 3',5-Dihydroxy-4',5',6,7,8-pentamethoxyflavon 5-Hydroxy-2-(3-hydroxy-4,5-dimethoxyphenyl)-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C20H20O9 |
| Mw |
404.11073224 |
| CAS RN |
29550-05-8 |
| C_ID |
C00003972
, 
|
| InChIKey |
FWJPIXFUGYRDQG-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H20O9/c1-24-13-7-9(6-11(22)16(13)25-2)12-8-10(21)14-15(23)18(26-3)20(28-5)19(27-4)17(14)29-12/h6-8,22-23H,1-5H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc(O)c1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Tamaricaceae | Tamarix dioica  | Ref. |
|
|
zoom in
| Organism | Gardenia lucida | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Rao,Indian J.Chem.,8,(1970),398 |
|---|
|