| Name |
Gardenin E 3',5,5'-Trihydroxy-4',6,7,8-tetramethoxyflavone 2-(3,5-Dihydroxy-4-methoxyphenyl)-5-hydroxy-6,7,8-trimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O9 |
| Mw |
390.09508217 |
| CAS RN |
29550-07-0 |
| C_ID |
C00003970
, 
|
| InChIKey |
PKCHTMJVPXNXSA-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O9/c1-24-15-10(21)5-8(6-11(15)22)12-7-9(20)13-14(23)17(25-2)19(27-4)18(26-3)16(13)28-12/h5-7,21-23H,1-4H3 |
| SMILES |
COc1c(O)cc(-c2cc(=O)c3c(O)c(OC)c(OC)c(OC)c3o2)cc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rubiaceae | Gardenia gummifera  | Ref. |
| Plantae | Rubiaceae | Gardenia lucida | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Tamaricaceae | Tamarix dioica  | Ref. |
|
|
zoom in
| Organism | Gardenia gummifera | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Rao,Indian J.Chem.,8,(1970),398
Kumari,Fitoterapia,60,(1989),558 |
|---|
|