| Name |
Luteolin 5,3'-dimethyl ether Chrysoeriol 5-methyl ether 7-Hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-methoxy-4H-1-benzopyran-4-one |
| Formula |
C17H14O6 |
| Mw |
314.07903818 |
| CAS RN |
62346-14-9 |
| C_ID |
C00003866
, 
|
| InChIKey |
JDMXMMBASFOTIF-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O6/c1-21-14-5-9(3-4-11(14)19)13-8-12(20)17-15(22-2)6-10(18)7-16(17)23-13/h3-8,18-19H,1-2H3 |
| SMILES |
COc1cc(-c2cc(=O)c3c(OC)cc(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Medicago x varia | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
|
|
zoom in
| Organism | Medicago x varia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Gehring,Naturforsch.,35C,(1980),380 |
|---|
|