| Name |
Cerrosillin 5,6,3',5'-tetramethoxyflavone 2-(3,5-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one |
| Formula |
C19H18O6 |
| Mw |
342.11033831 |
| CAS RN |
17182-56-8 |
| C_ID |
C00003858
, 
|
| InChIKey |
OVNSWJOCOLCOSB-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O6/c1-21-12-7-11(8-13(9-12)22-2)17-10-14(20)18-15(25-17)5-6-16(23-3)19(18)24-4/h5-10H,1-4H3 |
| SMILES |
COc1cc(OC)cc(-c2cc(=O)c3c(OC)c(OC)ccc3o2)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Casimiroa edulis  | Ref. |
| Plantae | Rutaceae | Casimiroa tetrameria  | Ref. |
| Plantae | Rutaceae | Sargentia greggii | Ref. |
|
|
zoom in
| Organism | Casimiroa edulis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Dreyer, J.Org.Chem., 33,(1968),3577
Dominguez,Phytochem.,11,(1972),2648 |
|---|
|