| Name |
Scutellarein 5,6,7,4'-tetramethyl ether 5,6,7,4'-Tetramethoxyflavone 5,6,7-Trimethoxy-2-(4-methoxyphenyl)-4H-1-benzopyran-4-one Tetramethylscutellarein Scutellarein tetramethyl ether |
| Formula |
C19H18O6 |
| Mw |
342.11033831 |
| CAS RN |
1168-42-9 |
| C_ID |
C00003841
, 
|
| InChIKey |
URSUMOWUGDXZHU-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C19H18O6/c1-21-12-7-5-11(6-8-12)14-9-13(20)17-15(25-14)10-16(22-2)18(23-3)19(17)24-4/h5-10H,1-4H3 |
| SMILES |
COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)cc3o2)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Chromolaena odorata  | Ref. |
| Plantae | Labiatae | Callicarpa japonica | Ref. |
| Plantae | Labiatae | Marrubium peregrinum  | Ref. |
| Plantae | Labiatae | Mentha x citrata | Ref. |
| Plantae | Labiatae | Orthosiphon aristatus  | Ref. |
| Plantae | Labiatae | Orthosiphon spicatus | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Moraceae | Ficus altissima  | Ref. |
| Plantae | Plantaginaceae | Kickxia spuria | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus spp. | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| - | - | Colebrookia oppositifolia | Ref. |
|
|
zoom in
| Organism | Ageratina conyzoides | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|