| Name |
5,7,2'-Trihydroxy-6-methoxyflavone |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
86926-51-4 |
| C_ID |
C00003833
, 
|
| InChIKey |
VHNWVABJHPRFGC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-16-11(19)7-13-14(15(16)20)10(18)6-12(22-13)8-4-2-3-5-9(8)17/h2-7,17,19-20H,1H3 |
| SMILES |
COc1c(O)cc2oc(-c3ccccc3O)cc(=O)c2c1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
|
|
zoom in
| Organism | Scutellaria amoena | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999) |
|---|
|