| Name |
Titonine 7,4'-Dimethoxy-3'-hydroxyflavone |
| Formula |
C17H14O5 |
| Mw |
298.08412356 |
| CAS RN |
30867-08-4 |
| C_ID |
C00003827
, 
|
| InChIKey |
QPWBUKXPEDEBQI-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C17H14O5/c1-20-11-4-5-12-13(18)9-16(22-17(12)8-11)10-3-6-15(21-2)14(19)7-10/h3-9,19H,1-2H3 |
| SMILES |
COc1ccc2c(=O)cc(-c3ccc(OC)c(O)c3)oc2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Tithonia tubaeformis | Ref. |
| Plantae | Fabaceae | Albizia odoratissima  | Ref. |
| Plantae | Fabaceae | Calliandra inermis | Ref. |
| Plantae | Myristicaceae | Virola michelii  | Ref. |
|
|
zoom in
| Organism | Tithonia tubaeformis | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Correa, Bull.Soc.Chim.Fr.,(1971),475
La Duke,Am.J.Bot.,69,(1982)784 |
|---|
|