| Name |
5,8,2'-Trihydroxyflavone |
| Formula |
C15H10O5 |
| Mw |
270.05282343 |
| CAS RN |
34285-16-0 |
| C_ID |
C00003822
, 
|
| InChIKey |
PNLMQENISKSSNZ-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O5/c16-9-4-2-1-3-8(9)13-7-12(19)14-10(17)5-6-11(18)15(14)20-13/h1-7,16-18H |
| SMILES |
O=c1cc(-c2ccccc2O)oc2c(O)ccc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Primulaceae | Primula florindae | Ref. |
| Plantae | Primulaceae | Primula malacoides | Ref. |
| Plantae | Primulaceae | Primula waltonii | Ref. |
|
|
zoom in
| Organism | Primula florindae | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Bouillant, R.Acad.Sci.,Ser.D,273,(1971),2961
Wheeler,J.Chem.Soc.,(1955),4249 |
|---|
|